C24H23NO5 — CID 101092020
dibenzyl (2S)-2-(cyclopenta-2,4-diene-1-carbonylamino)butanedioate (PubChem CID 101092020) has the molecular formula C24H23NO5 and a molecular weight of 405.45 g/mol. Its IUPAC name is dibenzyl (2S)-2-(cyclopenta-2,4-diene-1-carbonylamino)butanedioate.
| Compound Name | dibenzyl (2S)-2-(cyclopenta-2,4-diene-1-carbonylamino)butanedioate |
|---|---|
| PubChem CID | 101092020 |
| Molecular Formula | C24H23NO5 |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | dibenzyl (2S)-2-(cyclopenta-2,4-diene-1-carbonylamino)butanedioate |
| SMILES | O=C(C[C@H](NC(=O)C1C=CC=C1)C(=O)OCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C24H23NO5/c26-22(29-16-18-9-3-1-4-10-18)15-21(25-23(27)20-13-7-8-14-20)24(28)30-17-19-11-5-2-6-12-19/h1-14,20-21H,15-17H2,(H,25,27)/t21-/m0/s1 |
| InChIKey | SOBWYOGIGQEOET-NRFANRHFSA-N |
| XLogP | 3.09 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |