C42H40N6O10 — CID 53386919
dibenzyl (2R)-2-[[3,6-diamino-5-[[(2R)-1,4-dioxo-1,4-bis(phenylmethoxy)butan-2-yl]carbamoyl]pyrazine-2-carbonyl]amino]butanedioate (PubChem CID 53386919) has the molecular formula C42H40N6O10 and a molecular weight of 788.81 g/mol. Its IUPAC name is dibenzyl (2R)-2-[[3,6-diamino-5-[[(2R)-1,4-dioxo-1,4-bis(phenylmethoxy)butan-2-yl]carbamoyl]pyrazine-2-carbonyl]amino]butanedioate.
| Compound Name | dibenzyl (2R)-2-[[3,6-diamino-5-[[(2R)-1,4-dioxo-1,4-bis(phenylmethoxy)butan-2-yl]carbamoyl]pyrazine-2-carbonyl]amino]butanedioate |
|---|---|
| PubChem CID | 53386919 |
| Molecular Formula | C42H40N6O10 |
| Molecular Weight | 788.81 g/mol |
| Exact Mass | 788.28 |
| IUPAC Name | dibenzyl (2R)-2-[[3,6-diamino-5-[[(2R)-1,4-dioxo-1,4-bis(phenylmethoxy)butan-2-yl]carbamoyl]pyrazine-2-carbonyl]amino]butanedioate |
| SMILES | Nc1nc(C(=O)N[C@H](CC(=O)OCc2ccccc2)C(=O)OCc2ccccc2)c(N)nc1C(=O)N[C@H](CC(=O)OCc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C42H40N6O10/c43-37-35(39(51)45-31(41(53)57-25-29-17-9-3-10-18-29)21-33(49)55-23-27-13-5-1-6-14-27)47-38(44)36(48-37)40(52)46-32(42(54)58-26-30-19-11-4-12-20-30)22-34(50)56-24-28-15-7-2-8-16-28/h1-20,31-32H,21-26H2,(H2,44,47)(H2,43,48)(H,45,51)(H,46,52)/t31-,32-/m1/s1 |
| InChIKey | SVQDEJSQMGCFNM-ROJLCIKYSA-N |
| XLogP | 3.59 |
| TPSA | 241.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 788.81 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|