C25H22Cl2N2O5 — CID 27155333
dibenzyl (2R)-2-[(3,4-dichlorophenyl)carbamoylamino]butanedioate (PubChem CID 27155333) has the molecular formula C25H22Cl2N2O5 and a molecular weight of 501.37 g/mol. Its IUPAC name is dibenzyl (2R)-2-[(3,4-dichlorophenyl)carbamoylamino]butanedioate.
| Compound Name | dibenzyl (2R)-2-[(3,4-dichlorophenyl)carbamoylamino]butanedioate |
|---|---|
| PubChem CID | 27155333 |
| Molecular Formula | C25H22Cl2N2O5 |
| Molecular Weight | 501.37 g/mol |
| Exact Mass | 500.09 |
| IUPAC Name | dibenzyl (2R)-2-[(3,4-dichlorophenyl)carbamoylamino]butanedioate |
| SMILES | O=C(Nc1ccc(Cl)c(Cl)c1)N[C@H](CC(=O)OCc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C25H22Cl2N2O5/c26-20-12-11-19(13-21(20)27)28-25(32)29-22(24(31)34-16-18-9-5-2-6-10-18)14-23(30)33-15-17-7-3-1-4-8-17/h1-13,22H,14-16H2,(H2,28,29,32)/t22-/m1/s1 |
| InChIKey | JGRHENJHGNRHFW-JOCHJYFZSA-N |
| XLogP | 5.36 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.37 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |