C37H36N2O9 — CID 99653681
dibenzyl (2R)-2-[[(2S)-4-oxo-4-phenylmethoxy-2-(phenylmethoxycarbonylamino)butanoyl]amino]butanedioate (PubChem CID 99653681) has the molecular formula C37H36N2O9 and a molecular weight of 652.70 g/mol. Its IUPAC name is dibenzyl (2R)-2-[[(2S)-4-oxo-4-phenylmethoxy-2-(phenylmethoxycarbonylamino)butanoyl]amino]butanedioate.
| Compound Name | dibenzyl (2R)-2-[[(2S)-4-oxo-4-phenylmethoxy-2-(phenylmethoxycarbonylamino)butanoyl]amino]butanedioate |
|---|---|
| PubChem CID | 99653681 |
| Molecular Formula | C37H36N2O9 |
| Molecular Weight | 652.70 g/mol |
| Exact Mass | 652.24 |
| IUPAC Name | dibenzyl (2R)-2-[[(2S)-4-oxo-4-phenylmethoxy-2-(phenylmethoxycarbonylamino)butanoyl]amino]butanedioate |
| SMILES | O=C(C[C@H](NC(=O)OCc1ccccc1)C(=O)N[C@H](CC(=O)OCc1ccccc1)C(=O)OCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C37H36N2O9/c40-33(45-23-27-13-5-1-6-14-27)21-31(39-37(44)48-26-30-19-11-4-12-20-30)35(42)38-32(36(43)47-25-29-17-9-3-10-18-29)22-34(41)46-24-28-15-7-2-8-16-28/h1-20,31-32H,21-26H2,(H,38,42)(H,39,44)/t31-,32+/m0/s1 |
| InChIKey | DVOVAXBJPRPUNC-AJQTZOPKSA-N |
| XLogP | 4.78 |
| TPSA | 146.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.70 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|