C20H29NO6 — CID 174691464
bis(2-methylpropyl) (2R)-2-(phenylmethoxycarbonylamino)butanedioate (PubChem CID 174691464) has the molecular formula C20H29NO6 and a molecular weight of 379.45 g/mol. Its IUPAC name is bis(2-methylpropyl) (2R)-2-(phenylmethoxycarbonylamino)butanedioate.
| Compound Name | bis(2-methylpropyl) (2R)-2-(phenylmethoxycarbonylamino)butanedioate |
|---|---|
| PubChem CID | 174691464 |
| Molecular Formula | C20H29NO6 |
| Molecular Weight | 379.45 g/mol |
| Exact Mass | 379.20 |
| IUPAC Name | bis(2-methylpropyl) (2R)-2-(phenylmethoxycarbonylamino)butanedioate |
| SMILES | CC(C)COC(=O)C[C@@H](NC(=O)OCc1ccccc1)C(=O)OCC(C)C |
| InChI | InChI=1S/C20H29NO6/c1-14(2)11-25-18(22)10-17(19(23)26-12-15(3)4)21-20(24)27-13-16-8-6-5-7-9-16/h5-9,14-15,17H,10-13H2,1-4H3,(H,21,24)/t17-/m1/s1 |
| InChIKey | WPYBKFYJXFVNRF-QGZVFWFLSA-N |
| XLogP | 3.07 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.45 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|