C18H27NO5 — CID 10759382
2-methylpropyl 2-(2-methylpropoxy)-2-(phenylmethoxycarbonylamino)acetate (PubChem CID 10759382) has the molecular formula C18H27NO5 and a molecular weight of 337.42 g/mol. Its IUPAC name is 2-methylpropyl 2-(2-methylpropoxy)-2-(phenylmethoxycarbonylamino)acetate.
| Compound Name | 2-methylpropyl 2-(2-methylpropoxy)-2-(phenylmethoxycarbonylamino)acetate |
|---|---|
| PubChem CID | 10759382 |
| Molecular Formula | C18H27NO5 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.19 |
| IUPAC Name | 2-methylpropyl 2-(2-methylpropoxy)-2-(phenylmethoxycarbonylamino)acetate |
| SMILES | CC(C)COC(=O)C(NC(=O)OCc1ccccc1)OCC(C)C |
| InChI | InChI=1S/C18H27NO5/c1-13(2)10-22-16(17(20)23-11-14(3)4)19-18(21)24-12-15-8-6-5-7-9-15/h5-9,13-14,16H,10-12H2,1-4H3,(H,19,21) |
| InChIKey | FYIQQVBIODSPDX-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|