C16H23NO7 — CID 138472794
4-(2-methylpropoxy)-4-oxo-3-(phenylmethoxycarbonylamino)butanoic acid;hydrate (PubChem CID 138472794) has the molecular formula C16H23NO7 and a molecular weight of 341.36 g/mol. Its IUPAC name is 4-(2-methylpropoxy)-4-oxo-3-(phenylmethoxycarbonylamino)butanoic acid;hydrate.
| Compound Name | 4-(2-methylpropoxy)-4-oxo-3-(phenylmethoxycarbonylamino)butanoic acid;hydrate |
|---|---|
| PubChem CID | 138472794 |
| Molecular Formula | C16H23NO7 |
| Molecular Weight | 341.36 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | 4-(2-methylpropoxy)-4-oxo-3-(phenylmethoxycarbonylamino)butanoic acid;hydrate |
| SMILES | CC(C)COC(=O)C(CC(=O)O)NC(=O)OCc1ccccc1.O |
| InChI | InChI=1S/C16H21NO6.H2O/c1-11(2)9-22-15(20)13(8-14(18)19)17-16(21)23-10-12-6-4-3-5-7-12;/h3-7,11,13H,8-10H2,1-2H3,(H,17,21)(H,18,19);1H2 |
| InChIKey | VIUKRVSVRGTONF-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 133.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.36 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |