C15H17NO7 — CID 70083852
5-acetyloxy-4-oxo-3-(phenylmethoxycarbonylamino)pentanoic acid (PubChem CID 70083852) has the molecular formula C15H17NO7 and a molecular weight of 323.30 g/mol. Its IUPAC name is 5-acetyloxy-4-oxo-3-(phenylmethoxycarbonylamino)pentanoic acid.
| Compound Name | 5-acetyloxy-4-oxo-3-(phenylmethoxycarbonylamino)pentanoic acid |
|---|---|
| PubChem CID | 70083852 |
| Molecular Formula | C15H17NO7 |
| Molecular Weight | 323.30 g/mol |
| Exact Mass | 323.10 |
| IUPAC Name | 5-acetyloxy-4-oxo-3-(phenylmethoxycarbonylamino)pentanoic acid |
| SMILES | CC(=O)OCC(=O)C(CC(=O)O)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C15H17NO7/c1-10(17)22-9-13(18)12(7-14(19)20)16-15(21)23-8-11-5-3-2-4-6-11/h2-6,12H,7-9H2,1H3,(H,16,21)(H,19,20) |
| InChIKey | YGHNIHBFWZKBCM-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.30 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |