C19H21NO6 — CID 70085689
3-acetamido-5-acetyloxy-4-oxopentanoic acid;naphthalene (PubChem CID 70085689) has the molecular formula C19H21NO6 and a molecular weight of 359.38 g/mol. Its IUPAC name is 3-acetamido-5-acetyloxy-4-oxopentanoic acid;naphthalene.
| Compound Name | 3-acetamido-5-acetyloxy-4-oxopentanoic acid;naphthalene |
|---|---|
| PubChem CID | 70085689 |
| Molecular Formula | C19H21NO6 |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | 3-acetamido-5-acetyloxy-4-oxopentanoic acid;naphthalene |
| SMILES | CC(=O)NC(CC(=O)O)C(=O)COC(C)=O.c1ccc2ccccc2c1 |
| InChI | InChI=1S/C10H8.C9H13NO6/c1-2-6-10-8-4-3-7-9(10)5-1;1-5(11)10-7(3-9(14)15)8(13)4-16-6(2)12/h1-8H;7H,3-4H2,1-2H3,(H,10,11)(H,14,15) |
| InChIKey | OJFWXWSHKMPYOR-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |