C40H47N5O11 — CID 70102318
4-[[2-acetamido-3-(1H-indol-3-yl)propanoyl]amino]-5-[[1-[(4-acetyloxy-1-carboxy-3-oxobutan-2-yl)amino]-3-methyl-1-oxobutan-2-yl]amino]-5-oxopentanoic acid;naphthalene (PubChem CID 70102318) has the molecular formula C40H47N5O11 and a molecular weight of 773.84 g/mol. Its IUPAC name is 4-[[2-acetamido-3-(1H-indol-3-yl)propanoyl]amino]-5-[[1-[(4-acetyloxy-1-carboxy-3-oxobutan-2-yl)amino]-3-methyl-1-oxobutan-2-yl]amino]-5-oxopentanoic acid;naphthalene.
| Compound Name | 4-[[2-acetamido-3-(1H-indol-3-yl)propanoyl]amino]-5-[[1-[(4-acetyloxy-1-carboxy-3-oxobutan-2-yl)amino]-3-methyl-1-oxobutan-2-yl]amino]-5-oxopentanoic acid;naphthalene |
|---|---|
| PubChem CID | 70102318 |
| Molecular Formula | C40H47N5O11 |
| Molecular Weight | 773.84 g/mol |
| Exact Mass | 773.33 |
| IUPAC Name | 4-[[2-acetamido-3-(1H-indol-3-yl)propanoyl]amino]-5-[[1-[(4-acetyloxy-1-carboxy-3-oxobutan-2-yl)amino]-3-methyl-1-oxobutan-2-yl]amino]-5-oxopentanoic acid;naphthalene |
| SMILES | CC(=O)NC(Cc1c[nH]c2ccccc12)C(=O)NC(CCC(=O)O)C(=O)NC(C(=O)NC(CC(=O)O)C(=O)COC(C)=O)C(C)C.c1ccc2ccccc2c1 |
| InChI | InChI=1S/C30H39N5O11.C10H8/c1-15(2)27(30(45)34-22(12-26(41)42)24(38)14-46-17(4)37)35-28(43)21(9-10-25(39)40)33-29(44)23(32-16(3)36)11-18-13-31-20-8-6-5-7-19(18)20;1-2-6-10-8-4-3-7-9(10)5-1/h5-8,13,15,21-23,27,31H,9-12,14H2,1-4H3,(H,32,36)(H,33,44)(H,34,45)(H,35,43)(H,39,40)(H,41,42);1-8H |
| InChIKey | ZGCZRCTVQSZKGR-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 250.16 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 773.84 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |