C23H26N2O7 — CID 54523917
3-(2-acetamidobutanoylamino)-5-(2-naphthalen-1-ylacetyl)oxy-4-oxopentanoic acid (PubChem CID 54523917) has the molecular formula C23H26N2O7 and a molecular weight of 442.47 g/mol. Its IUPAC name is 3-(2-acetamidobutanoylamino)-5-(2-naphthalen-1-ylacetyl)oxy-4-oxopentanoic acid.
| Compound Name | 3-(2-acetamidobutanoylamino)-5-(2-naphthalen-1-ylacetyl)oxy-4-oxopentanoic acid |
|---|---|
| PubChem CID | 54523917 |
| Molecular Formula | C23H26N2O7 |
| Molecular Weight | 442.47 g/mol |
| Exact Mass | 442.17 |
| IUPAC Name | 3-(2-acetamidobutanoylamino)-5-(2-naphthalen-1-ylacetyl)oxy-4-oxopentanoic acid |
| SMILES | CCC(NC(C)=O)C(=O)NC(CC(=O)O)C(=O)COC(=O)Cc1cccc2ccccc12 |
| InChI | InChI=1S/C23H26N2O7/c1-3-18(24-14(2)26)23(31)25-19(12-21(28)29)20(27)13-32-22(30)11-16-9-6-8-15-7-4-5-10-17(15)16/h4-10,18-19H,3,11-13H2,1-2H3,(H,24,26)(H,25,31)(H,28,29) |
| InChIKey | YRTVBZLOMFGSOT-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 138.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.47 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |