C21H25N3O7 — CID 67578272
5-acetyloxy-3-[2-(carbamoylamino)propanoylamino]-4-oxopentanoic acid;naphthalene (PubChem CID 67578272) has the molecular formula C21H25N3O7 and a molecular weight of 431.45 g/mol. Its IUPAC name is 5-acetyloxy-3-[2-(carbamoylamino)propanoylamino]-4-oxopentanoic acid;naphthalene.
| Compound Name | 5-acetyloxy-3-[2-(carbamoylamino)propanoylamino]-4-oxopentanoic acid;naphthalene |
|---|---|
| PubChem CID | 67578272 |
| Molecular Formula | C21H25N3O7 |
| Molecular Weight | 431.45 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | 5-acetyloxy-3-[2-(carbamoylamino)propanoylamino]-4-oxopentanoic acid;naphthalene |
| SMILES | CC(=O)OCC(=O)C(CC(=O)O)NC(=O)C(C)NC(N)=O.c1ccc2ccccc2c1 |
| InChI | InChI=1S/C11H17N3O7.C10H8/c1-5(13-11(12)20)10(19)14-7(3-9(17)18)8(16)4-21-6(2)15;1-2-6-10-8-4-3-7-9(10)5-1/h5,7H,3-4H2,1-2H3,(H,14,19)(H,17,18)(H3,12,13,20);1-8H |
| InChIKey | BZGBBBMPULTNMY-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 164.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.45 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |