C29H33NO7 — CID 67577177
tert-butyl 5-acetyloxy-4-oxo-3-(phenylmethoxycarbonylamino)pentanoate;naphthalene (PubChem CID 67577177) has the molecular formula C29H33NO7 and a molecular weight of 507.58 g/mol. Its IUPAC name is tert-butyl 5-acetyloxy-4-oxo-3-(phenylmethoxycarbonylamino)pentanoate;naphthalene.
| Compound Name | tert-butyl 5-acetyloxy-4-oxo-3-(phenylmethoxycarbonylamino)pentanoate;naphthalene |
|---|---|
| PubChem CID | 67577177 |
| Molecular Formula | C29H33NO7 |
| Molecular Weight | 507.58 g/mol |
| Exact Mass | 507.23 |
| IUPAC Name | tert-butyl 5-acetyloxy-4-oxo-3-(phenylmethoxycarbonylamino)pentanoate;naphthalene |
| SMILES | CC(=O)OCC(=O)C(CC(=O)OC(C)(C)C)NC(=O)OCc1ccccc1.c1ccc2ccccc2c1 |
| InChI | InChI=1S/C19H25NO7.C10H8/c1-13(21)25-12-16(22)15(10-17(23)27-19(2,3)4)20-18(24)26-11-14-8-6-5-7-9-14;1-2-6-10-8-4-3-7-9(10)5-1/h5-9,15H,10-12H2,1-4H3,(H,20,24);1-8H |
| InChIKey | UCTQKTKVVSHLML-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.58 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|