C20H30N2O7 — CID 69075780
tert-butyl 4-(2,2-dimethoxyethylamino)-4-oxo-3-(phenylmethoxycarbonylamino)butanoate (PubChem CID 69075780) has the molecular formula C20H30N2O7 and a molecular weight of 410.47 g/mol. Its IUPAC name is tert-butyl 4-(2,2-dimethoxyethylamino)-4-oxo-3-(phenylmethoxycarbonylamino)butanoate.
| Compound Name | tert-butyl 4-(2,2-dimethoxyethylamino)-4-oxo-3-(phenylmethoxycarbonylamino)butanoate |
|---|---|
| PubChem CID | 69075780 |
| Molecular Formula | C20H30N2O7 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | tert-butyl 4-(2,2-dimethoxyethylamino)-4-oxo-3-(phenylmethoxycarbonylamino)butanoate |
| SMILES | COC(CNC(=O)C(CC(=O)OC(C)(C)C)NC(=O)OCc1ccccc1)OC |
| InChI | InChI=1S/C20H30N2O7/c1-20(2,3)29-16(23)11-15(18(24)21-12-17(26-4)27-5)22-19(25)28-13-14-9-7-6-8-10-14/h6-10,15,17H,11-13H2,1-5H3,(H,21,24)(H,22,25) |
| InChIKey | MSTCUGYEBCFUPL-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 112.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|