C29H44N4O10 — CID 175080930
4-O-tert-butyl 1-O-methyl 2-[[2-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-(phenylmethoxycarbonylamino)pentanoyl]amino]acetyl]amino]butanedioate (PubChem CID 175080930) has the molecular formula C29H44N4O10 and a molecular weight of 608.69 g/mol. Its IUPAC name is 4-O-tert-butyl 1-O-methyl 2-[[2-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-(phenylmethoxycarbonylamino)pentanoyl]amino]acetyl]amino]butanedioate.
| Compound Name | 4-O-tert-butyl 1-O-methyl 2-[[2-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-(phenylmethoxycarbonylamino)pentanoyl]amino]acetyl]amino]butanedioate |
|---|---|
| PubChem CID | 175080930 |
| Molecular Formula | C29H44N4O10 |
| Molecular Weight | 608.69 g/mol |
| Exact Mass | 608.31 |
| IUPAC Name | 4-O-tert-butyl 1-O-methyl 2-[[2-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-(phenylmethoxycarbonylamino)pentanoyl]amino]acetyl]amino]butanedioate |
| SMILES | COC(=O)C(CC(=O)OC(C)(C)C)NC(=O)CNC(=O)C(CCCNC(=O)OCc1ccccc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C29H44N4O10/c1-28(2,3)42-23(35)16-21(25(37)40-7)32-22(34)17-31-24(36)20(33-27(39)43-29(4,5)6)14-11-15-30-26(38)41-18-19-12-9-8-10-13-19/h8-10,12-13,20-21H,11,14-18H2,1-7H3,(H,30,38)(H,31,36)(H,32,34)(H,33,39) |
| InChIKey | XQLFURAGJZCYQA-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 187.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.69 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|