C28H44N4O8 — CID 154642459
tert-butyl (2S)-2-[[2-[[(2S)-2-amino-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoyl]amino]acetyl]amino]-6-(phenylmethoxycarbonylamino)hexanoate (PubChem CID 154642459) has the molecular formula C28H44N4O8 and a molecular weight of 564.68 g/mol. Its IUPAC name is tert-butyl (2S)-2-[[2-[[(2S)-2-amino-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoyl]amino]acetyl]amino]-6-(phenylmethoxycarbonylamino)hexanoate.
| Compound Name | tert-butyl (2S)-2-[[2-[[(2S)-2-amino-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoyl]amino]acetyl]amino]-6-(phenylmethoxycarbonylamino)hexanoate |
|---|---|
| PubChem CID | 154642459 |
| Molecular Formula | C28H44N4O8 |
| Molecular Weight | 564.68 g/mol |
| Exact Mass | 564.32 |
| IUPAC Name | tert-butyl (2S)-2-[[2-[[(2S)-2-amino-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoyl]amino]acetyl]amino]-6-(phenylmethoxycarbonylamino)hexanoate |
| SMILES | CC(C)(C)OC(=O)C[C@H](N)C(=O)NCC(=O)N[C@@H](CCCCNC(=O)OCc1ccccc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C28H44N4O8/c1-27(2,3)39-23(34)16-20(29)24(35)31-17-22(33)32-21(25(36)40-28(4,5)6)14-10-11-15-30-26(37)38-18-19-12-8-7-9-13-19/h7-9,12-13,20-21H,10-11,14-18,29H2,1-6H3,(H,30,37)(H,31,35)(H,32,33)/t20-,21-/m0/s1 |
| InChIKey | USHLLKNNBMCAPD-SFTDATJTSA-N |
| XLogP | 2.08 |
| TPSA | 175.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.68 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|