C41H62N4O12 — CID 171762661
tert-butyl 3-[2-[2-[2-[2-[[6-(phenylmethoxycarbonylamino)-2-[4-(phenylmethoxycarbonylamino)butanoylamino]hexanoyl]amino]ethoxy]ethoxy]ethoxy]ethoxy]propanoate (PubChem CID 171762661) has the molecular formula C41H62N4O12 and a molecular weight of 802.96 g/mol. Its IUPAC name is tert-butyl 3-[2-[2-[2-[2-[[6-(phenylmethoxycarbonylamino)-2-[4-(phenylmethoxycarbonylamino)butanoylamino]hexanoyl]amino]ethoxy]ethoxy]ethoxy]ethoxy]propanoate.
| Compound Name | tert-butyl 3-[2-[2-[2-[2-[[6-(phenylmethoxycarbonylamino)-2-[4-(phenylmethoxycarbonylamino)butanoylamino]hexanoyl]amino]ethoxy]ethoxy]ethoxy]ethoxy]propanoate |
|---|---|
| PubChem CID | 171762661 |
| Molecular Formula | C41H62N4O12 |
| Molecular Weight | 802.96 g/mol |
| Exact Mass | 802.44 |
| IUPAC Name | tert-butyl 3-[2-[2-[2-[2-[[6-(phenylmethoxycarbonylamino)-2-[4-(phenylmethoxycarbonylamino)butanoylamino]hexanoyl]amino]ethoxy]ethoxy]ethoxy]ethoxy]propanoate |
| SMILES | CC(C)(C)OC(=O)CCOCCOCCOCCOCCNC(=O)C(CCCCNC(=O)OCc1ccccc1)NC(=O)CCCNC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C41H62N4O12/c1-41(2,3)57-37(47)19-23-51-25-27-53-29-30-54-28-26-52-24-22-42-38(48)35(17-10-11-20-43-39(49)55-31-33-13-6-4-7-14-33)45-36(46)18-12-21-44-40(50)56-32-34-15-8-5-9-16-34/h4-9,13-16,35H,10-12,17-32H2,1-3H3,(H,42,48)(H,43,49)(H,44,50)(H,45,46) |
| InChIKey | DDUPQTYKVPDOQW-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 198.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 802.96 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|