C22H34N2O7 — CID 169158651
tert-butyl 3-[2-[2-[3-(phenylmethoxycarbonylamino)propanoylamino]ethoxy]ethoxy]propanoate (PubChem CID 169158651) has the molecular formula C22H34N2O7 and a molecular weight of 438.52 g/mol. Its IUPAC name is tert-butyl 3-[2-[2-[3-(phenylmethoxycarbonylamino)propanoylamino]ethoxy]ethoxy]propanoate.
| Compound Name | tert-butyl 3-[2-[2-[3-(phenylmethoxycarbonylamino)propanoylamino]ethoxy]ethoxy]propanoate |
|---|---|
| PubChem CID | 169158651 |
| Molecular Formula | C22H34N2O7 |
| Molecular Weight | 438.52 g/mol |
| Exact Mass | 438.24 |
| IUPAC Name | tert-butyl 3-[2-[2-[3-(phenylmethoxycarbonylamino)propanoylamino]ethoxy]ethoxy]propanoate |
| SMILES | CC(C)(C)OC(=O)CCOCCOCCNC(=O)CCNC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C22H34N2O7/c1-22(2,3)31-20(26)10-13-28-15-16-29-14-12-23-19(25)9-11-24-21(27)30-17-18-7-5-4-6-8-18/h4-8H,9-17H2,1-3H3,(H,23,25)(H,24,27) |
| InChIKey | NOWABDKAZCNLPL-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 112.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.52 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|