C18H27NO6 — CID 11325667
tert-butyl 2-[2-[2-(phenylmethoxycarbonylamino)ethoxy]ethoxy]acetate (PubChem CID 11325667) has the molecular formula C18H27NO6 and a molecular weight of 353.42 g/mol. Its IUPAC name is tert-butyl 2-[2-[2-(phenylmethoxycarbonylamino)ethoxy]ethoxy]acetate.
| Compound Name | tert-butyl 2-[2-[2-(phenylmethoxycarbonylamino)ethoxy]ethoxy]acetate |
|---|---|
| PubChem CID | 11325667 |
| Molecular Formula | C18H27NO6 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.18 |
| IUPAC Name | tert-butyl 2-[2-[2-(phenylmethoxycarbonylamino)ethoxy]ethoxy]acetate |
| SMILES | CC(C)(C)OC(=O)COCCOCCNC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C18H27NO6/c1-18(2,3)25-16(20)14-23-12-11-22-10-9-19-17(21)24-13-15-7-5-4-6-8-15/h4-8H,9-14H2,1-3H3,(H,19,21) |
| InChIKey | YIENFGGXLDBMBT-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|