C22H35FN2O6 — CID 138695393
benzyl N-[2-fluoro-3-methyl-3-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxy]butyl]carbamate (PubChem CID 138695393) has the molecular formula C22H35FN2O6 and a molecular weight of 442.53 g/mol. Its IUPAC name is benzyl N-[2-fluoro-3-methyl-3-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxy]butyl]carbamate.
| Compound Name | benzyl N-[2-fluoro-3-methyl-3-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxy]butyl]carbamate |
|---|---|
| PubChem CID | 138695393 |
| Molecular Formula | C22H35FN2O6 |
| Molecular Weight | 442.53 g/mol |
| Exact Mass | 442.25 |
| IUPAC Name | benzyl N-[2-fluoro-3-methyl-3-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxy]butyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCOCCOC(C)(C)C(F)CNC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C22H35FN2O6/c1-21(2,3)31-20(27)24-11-12-28-13-14-30-22(4,5)18(23)15-25-19(26)29-16-17-9-7-6-8-10-17/h6-10,18H,11-16H2,1-5H3,(H,24,27)(H,25,26) |
| InChIKey | GRBQIPLMBJCFMO-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.53 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|