C31H47FN2O6 — CID 155680643
tert-butyl N-[2-[2-[2-[2-[4-(benzhydrylamino)-3-fluoro-2-methylbutan-2-yl]oxyethoxy]ethoxy]ethoxy]ethyl]carbamate (PubChem CID 155680643) has the molecular formula C31H47FN2O6 and a molecular weight of 562.72 g/mol. Its IUPAC name is tert-butyl N-[2-[2-[2-[2-[4-(benzhydrylamino)-3-fluoro-2-methylbutan-2-yl]oxyethoxy]ethoxy]ethoxy]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-[2-[2-[4-(benzhydrylamino)-3-fluoro-2-methylbutan-2-yl]oxyethoxy]ethoxy]ethoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 155680643 |
| Molecular Formula | C31H47FN2O6 |
| Molecular Weight | 562.72 g/mol |
| Exact Mass | 562.34 |
| IUPAC Name | tert-butyl N-[2-[2-[2-[2-[4-(benzhydrylamino)-3-fluoro-2-methylbutan-2-yl]oxyethoxy]ethoxy]ethoxy]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCOCCOCCOCCOC(C)(C)C(F)CNC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H47FN2O6/c1-30(2,3)40-29(35)33-16-17-36-18-19-37-20-21-38-22-23-39-31(4,5)27(32)24-34-28(25-12-8-6-9-13-25)26-14-10-7-11-15-26/h6-15,27-28,34H,16-24H2,1-5H3,(H,33,35) |
| InChIKey | HDLQIGLRQRPJMX-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 87.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.72 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|