C27H33INO3P — CID 140698656
tert-butyl N-[2-[2-[iodo(triphenyl)-λ5-phosphanyl]ethoxy]ethyl]carbamate (PubChem CID 140698656) has the molecular formula C27H33INO3P and a molecular weight of 577.44 g/mol. Its IUPAC name is tert-butyl N-[2-[2-[iodo(triphenyl)-λ5-phosphanyl]ethoxy]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-[iodo(triphenyl)-λ5-phosphanyl]ethoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 140698656 |
| Molecular Formula | C27H33INO3P |
| Molecular Weight | 577.44 g/mol |
| Exact Mass | 577.12 |
| IUPAC Name | tert-butyl N-[2-[2-[iodo(triphenyl)-λ5-phosphanyl]ethoxy]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCOCCP(I)(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H33INO3P/c1-27(2,3)32-26(30)29-19-20-31-21-22-33(28,23-13-7-4-8-14-23,24-15-9-5-10-16-24)25-17-11-6-12-18-25/h4-18H,19-22H2,1-3H3,(H,29,30) |
| InChIKey | LMGJXMVQRRQZJD-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.44 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|