C19H30INO6 — CID 138695945
tert-butyl N-[2-[2-[2-[2-(4-iodophenoxy)ethoxy]ethoxy]ethoxy]ethyl]carbamate (PubChem CID 138695945) has the molecular formula C19H30INO6 and a molecular weight of 495.35 g/mol. Its IUPAC name is tert-butyl N-[2-[2-[2-[2-(4-iodophenoxy)ethoxy]ethoxy]ethoxy]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-[2-[2-(4-iodophenoxy)ethoxy]ethoxy]ethoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 138695945 |
| Molecular Formula | C19H30INO6 |
| Molecular Weight | 495.35 g/mol |
| Exact Mass | 495.11 |
| IUPAC Name | tert-butyl N-[2-[2-[2-[2-(4-iodophenoxy)ethoxy]ethoxy]ethoxy]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCOCCOCCOCCOc1ccc(I)cc1 |
| InChI | InChI=1S/C19H30INO6/c1-19(2,3)27-18(22)21-8-9-23-10-11-24-12-13-25-14-15-26-17-6-4-16(20)5-7-17/h4-7H,8-15H2,1-3H3,(H,21,22) |
| InChIKey | HKVBRCOMWPGYKJ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.35 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|