C16H27NO3 — CID 153377794
tert-butyl N-[2-(4-methylphenoxy)ethyl]carbamate;ethane (PubChem CID 153377794) has the molecular formula C16H27NO3 and a molecular weight of 281.40 g/mol. Its IUPAC name is tert-butyl N-[2-(4-methylphenoxy)ethyl]carbamate;ethane.
| Compound Name | tert-butyl N-[2-(4-methylphenoxy)ethyl]carbamate;ethane |
|---|---|
| PubChem CID | 153377794 |
| Molecular Formula | C16H27NO3 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.20 |
| IUPAC Name | tert-butyl N-[2-(4-methylphenoxy)ethyl]carbamate;ethane |
| SMILES | CC.Cc1ccc(OCCNC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C14H21NO3.C2H6/c1-11-5-7-12(8-6-11)17-10-9-15-13(16)18-14(2,3)4;1-2/h5-8H,9-10H2,1-4H3,(H,15,16);1-2H3 |
| InChIKey | KMQBULQVAYWADE-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|