C22H40N2O7 — CID 144965448
ethane;2-[2-[2-(4-methylphenoxy)ethoxy]ethoxy]ethanamine;2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid (PubChem CID 144965448) has the molecular formula C22H40N2O7 and a molecular weight of 444.57 g/mol. Its IUPAC name is ethane;2-[2-[2-(4-methylphenoxy)ethoxy]ethoxy]ethanamine;2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid.
| Compound Name | ethane;2-[2-[2-(4-methylphenoxy)ethoxy]ethoxy]ethanamine;2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid |
|---|---|
| PubChem CID | 144965448 |
| Molecular Formula | C22H40N2O7 |
| Molecular Weight | 444.57 g/mol |
| Exact Mass | 444.28 |
| IUPAC Name | ethane;2-[2-[2-(4-methylphenoxy)ethoxy]ethoxy]ethanamine;2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid |
| SMILES | CC.CC(C)(C)OC(=O)NCC(=O)O.Cc1ccc(OCCOCCOCCN)cc1 |
| InChI | InChI=1S/C13H21NO3.C7H13NO4.C2H6/c1-12-2-4-13(5-3-12)17-11-10-16-9-8-15-7-6-14;1-7(2,3)12-6(11)8-4-5(9)10;1-2/h2-5H,6-11,14H2,1H3;4H2,1-3H3,(H,8,11)(H,9,10);1-2H3 |
| InChIKey | IDLZJOIXBDJOSH-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 129.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.57 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|