C22H48N4O8 — CID 159460097
tert-butyl N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]carbamate (PubChem CID 159460097) has the molecular formula C22H48N4O8 and a molecular weight of 496.65 g/mol. Its IUPAC name is tert-butyl N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 159460097 |
| Molecular Formula | C22H48N4O8 |
| Molecular Weight | 496.65 g/mol |
| Exact Mass | 496.35 |
| IUPAC Name | tert-butyl N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCOCCOCCN.CC(C)(C)OC(=O)NCCOCCOCCN |
| InChI | InChI=1S/2C11H24N2O4/c2*1-11(2,3)17-10(14)13-5-7-16-9-8-15-6-4-12/h2*4-9,12H2,1-3H3,(H,13,14) |
| InChIKey | LUMFVVSVRKMQAA-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 165.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.65 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|