C14H29N3O5 — CID 166726831
tert-butyl N-[2-[2-[2-(3-aminopropanoylamino)ethoxy]ethoxy]ethyl]carbamate (PubChem CID 166726831) has the molecular formula C14H29N3O5 and a molecular weight of 319.40 g/mol. Its IUPAC name is tert-butyl N-[2-[2-[2-(3-aminopropanoylamino)ethoxy]ethoxy]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-[2-(3-aminopropanoylamino)ethoxy]ethoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 166726831 |
| Molecular Formula | C14H29N3O5 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.21 |
| IUPAC Name | tert-butyl N-[2-[2-[2-(3-aminopropanoylamino)ethoxy]ethoxy]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCOCCOCCNC(=O)CCN |
| InChI | InChI=1S/C14H29N3O5/c1-14(2,3)22-13(19)17-7-9-21-11-10-20-8-6-16-12(18)4-5-15/h4-11,15H2,1-3H3,(H,16,18)(H,17,19) |
| InChIKey | NTCCRCVWTOLUQX-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 111.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|