C15H28N2O7 — CID 135299262
2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl 4-[2-(2-hydroxyethoxy)ethylamino]-4-oxobutanoate (PubChem CID 135299262) has the molecular formula C15H28N2O7 and a molecular weight of 348.40 g/mol. Its IUPAC name is 2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl 4-[2-(2-hydroxyethoxy)ethylamino]-4-oxobutanoate.
| Compound Name | 2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl 4-[2-(2-hydroxyethoxy)ethylamino]-4-oxobutanoate |
|---|---|
| PubChem CID | 135299262 |
| Molecular Formula | C15H28N2O7 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.19 |
| IUPAC Name | 2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl 4-[2-(2-hydroxyethoxy)ethylamino]-4-oxobutanoate |
| SMILES | CC(C)(C)OC(=O)NCCOC(=O)CCC(=O)NCCOCCO |
| InChI | InChI=1S/C15H28N2O7/c1-15(2,3)24-14(21)17-7-10-23-13(20)5-4-12(19)16-6-9-22-11-8-18/h18H,4-11H2,1-3H3,(H,16,19)(H,17,21) |
| InChIKey | WNERBXYDOSCCNE-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 123.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|