C15H31NO5 — CID 131982939
N-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethyl]-4,4-dimethylpentanamide (PubChem CID 131982939) has the molecular formula C15H31NO5 and a molecular weight of 305.42 g/mol. Its IUPAC name is N-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethyl]-4,4-dimethylpentanamide.
| Compound Name | N-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethyl]-4,4-dimethylpentanamide |
|---|---|
| PubChem CID | 131982939 |
| Molecular Formula | C15H31NO5 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.22 |
| IUPAC Name | N-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethyl]-4,4-dimethylpentanamide |
| SMILES | CC(C)(C)CCC(=O)NCCOCCOCCOCCO |
| InChI | InChI=1S/C15H31NO5/c1-15(2,3)5-4-14(18)16-6-8-19-10-12-21-13-11-20-9-7-17/h17H,4-13H2,1-3H3,(H,16,18) |
| InChIKey | FLEVEUJUHPQPMX-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|