C22H43NO6 — CID 168855315
N-[2-[2-[2-[2-(4,4-dimethyl-3-oxopentoxy)ethoxy]ethoxy]ethoxy]ethyl]-4,4-dimethylpentanamide (PubChem CID 168855315) has the molecular formula C22H43NO6 and a molecular weight of 417.59 g/mol. Its IUPAC name is N-[2-[2-[2-[2-(4,4-dimethyl-3-oxopentoxy)ethoxy]ethoxy]ethoxy]ethyl]-4,4-dimethylpentanamide.
| Compound Name | N-[2-[2-[2-[2-(4,4-dimethyl-3-oxopentoxy)ethoxy]ethoxy]ethoxy]ethyl]-4,4-dimethylpentanamide |
|---|---|
| PubChem CID | 168855315 |
| Molecular Formula | C22H43NO6 |
| Molecular Weight | 417.59 g/mol |
| Exact Mass | 417.31 |
| IUPAC Name | N-[2-[2-[2-[2-(4,4-dimethyl-3-oxopentoxy)ethoxy]ethoxy]ethoxy]ethyl]-4,4-dimethylpentanamide |
| SMILES | CC(C)(C)CCC(=O)NCCOCCOCCOCCOCCC(=O)C(C)(C)C |
| InChI | InChI=1S/C22H43NO6/c1-21(2,3)9-7-20(25)23-10-12-27-14-16-29-18-17-28-15-13-26-11-8-19(24)22(4,5)6/h7-18H2,1-6H3,(H,23,25) |
| InChIKey | HPYCWUVDMCQSRT-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.59 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|