C19H37NO6 — CID 158125954
N-[2-[2-[2-[2-(4,4-dimethyl-3-oxopentoxy)ethoxy]ethoxy]ethoxy]ethyl]butanamide (PubChem CID 158125954) has the molecular formula C19H37NO6 and a molecular weight of 375.51 g/mol. Its IUPAC name is N-[2-[2-[2-[2-(4,4-dimethyl-3-oxopentoxy)ethoxy]ethoxy]ethoxy]ethyl]butanamide.
| Compound Name | N-[2-[2-[2-[2-(4,4-dimethyl-3-oxopentoxy)ethoxy]ethoxy]ethoxy]ethyl]butanamide |
|---|---|
| PubChem CID | 158125954 |
| Molecular Formula | C19H37NO6 |
| Molecular Weight | 375.51 g/mol |
| Exact Mass | 375.26 |
| IUPAC Name | N-[2-[2-[2-[2-(4,4-dimethyl-3-oxopentoxy)ethoxy]ethoxy]ethoxy]ethyl]butanamide |
| SMILES | CCCC(=O)NCCOCCOCCOCCOCCC(=O)C(C)(C)C |
| InChI | InChI=1S/C19H37NO6/c1-5-6-18(22)20-8-10-24-12-14-26-16-15-25-13-11-23-9-7-17(21)19(2,3)4/h5-16H2,1-4H3,(H,20,22) |
| InChIKey | FSEDRCOEZPEMLT-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.51 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|