C17H35NO4 — CID 59078266
1-[2-[2-[2-(tert-butylamino)ethoxy]ethoxy]ethoxy]-4,4-dimethylpentan-3-one (PubChem CID 59078266) has the molecular formula C17H35NO4 and a molecular weight of 317.47 g/mol. Its IUPAC name is 1-[2-[2-[2-(tert-butylamino)ethoxy]ethoxy]ethoxy]-4,4-dimethylpentan-3-one.
| Compound Name | 1-[2-[2-[2-(tert-butylamino)ethoxy]ethoxy]ethoxy]-4,4-dimethylpentan-3-one |
|---|---|
| PubChem CID | 59078266 |
| Molecular Formula | C17H35NO4 |
| Molecular Weight | 317.47 g/mol |
| Exact Mass | 317.26 |
| IUPAC Name | 1-[2-[2-[2-(tert-butylamino)ethoxy]ethoxy]ethoxy]-4,4-dimethylpentan-3-one |
| SMILES | CC(C)(C)NCCOCCOCCOCCC(=O)C(C)(C)C |
| InChI | InChI=1S/C17H35NO4/c1-16(2,3)15(19)7-9-20-11-13-22-14-12-21-10-8-18-17(4,5)6/h18H,7-14H2,1-6H3 |
| InChIKey | ZEVBMRHTPIRYLG-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.47 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|