C16H37NO3 — CID 158558331
methane;1-methoxy-4,4-dimethylpentan-3-one;N-(2-methoxyethyl)-2-methylpropan-2-amine (PubChem CID 158558331) has the molecular formula C16H37NO3 and a molecular weight of 291.48 g/mol. Its IUPAC name is methane;1-methoxy-4,4-dimethylpentan-3-one;N-(2-methoxyethyl)-2-methylpropan-2-amine.
| Compound Name | methane;1-methoxy-4,4-dimethylpentan-3-one;N-(2-methoxyethyl)-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 158558331 |
| Molecular Formula | C16H37NO3 |
| Molecular Weight | 291.48 g/mol |
| Exact Mass | 291.28 |
| IUPAC Name | methane;1-methoxy-4,4-dimethylpentan-3-one;N-(2-methoxyethyl)-2-methylpropan-2-amine |
| SMILES | C.COCCC(=O)C(C)(C)C.COCCNC(C)(C)C |
| InChI | InChI=1S/C8H16O2.C7H17NO.CH4/c1-8(2,3)7(9)5-6-10-4;1-7(2,3)8-5-6-9-4;/h5-6H2,1-4H3;8H,5-6H2,1-4H3;1H4 |
| InChIKey | HQOLIOGNFFOOGV-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.48 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|