C9H20N2O4S — CID 114815341
1-(2-methoxyethylsulfamoylamino)-3,3-dimethylbutan-2-one (PubChem CID 114815341) has the molecular formula C9H20N2O4S and a molecular weight of 252.34 g/mol. Its IUPAC name is 1-(2-methoxyethylsulfamoylamino)-3,3-dimethylbutan-2-one.
| Compound Name | 1-(2-methoxyethylsulfamoylamino)-3,3-dimethylbutan-2-one |
|---|---|
| PubChem CID | 114815341 |
| Molecular Formula | C9H20N2O4S |
| Molecular Weight | 252.34 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | 1-(2-methoxyethylsulfamoylamino)-3,3-dimethylbutan-2-one |
| SMILES | COCCNS(=O)(=O)NCC(=O)C(C)(C)C |
| InChI | InChI=1S/C9H20N2O4S/c1-9(2,3)8(12)7-11-16(13,14)10-5-6-15-4/h10-11H,5-7H2,1-4H3 |
| InChIKey | MUHOPHDLCXDULP-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.34 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|