C11H14N2O7S — CID 114814430
5-(2-methoxyethylsulfamoylamino)benzene-1,3-dicarboxylic acid (PubChem CID 114814430) has the molecular formula C11H14N2O7S and a molecular weight of 318.31 g/mol. Its IUPAC name is 5-(2-methoxyethylsulfamoylamino)benzene-1,3-dicarboxylic acid.
| Compound Name | 5-(2-methoxyethylsulfamoylamino)benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 114814430 |
| Molecular Formula | C11H14N2O7S |
| Molecular Weight | 318.31 g/mol |
| Exact Mass | 318.05 |
| IUPAC Name | 5-(2-methoxyethylsulfamoylamino)benzene-1,3-dicarboxylic acid |
| SMILES | COCCNS(=O)(=O)Nc1cc(C(=O)O)cc(C(=O)O)c1 |
| InChI | InChI=1S/C11H14N2O7S/c1-20-3-2-12-21(18,19)13-9-5-7(10(14)15)4-8(6-9)11(16)17/h4-6,12-13H,2-3H2,1H3,(H,14,15)(H,16,17) |
| InChIKey | UPJBDULSUHBMNV-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 142.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.31 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|