C9H14N2O5S2 — CID 114814326
5-(2-methoxyethylsulfamoylamino)-3-methylthiophene-2-carboxylic acid (PubChem CID 114814326) has the molecular formula C9H14N2O5S2 and a molecular weight of 294.35 g/mol. Its IUPAC name is 5-(2-methoxyethylsulfamoylamino)-3-methylthiophene-2-carboxylic acid.
| Compound Name | 5-(2-methoxyethylsulfamoylamino)-3-methylthiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 114814326 |
| Molecular Formula | C9H14N2O5S2 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.03 |
| IUPAC Name | 5-(2-methoxyethylsulfamoylamino)-3-methylthiophene-2-carboxylic acid |
| SMILES | COCCNS(=O)(=O)Nc1cc(C)c(C(=O)O)s1 |
| InChI | InChI=1S/C9H14N2O5S2/c1-6-5-7(17-8(6)9(12)13)11-18(14,15)10-3-4-16-2/h5,10-11H,3-4H2,1-2H3,(H,12,13) |
| InChIKey | MFHUFHPQFQFYQV-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|