C10H16N2O4S2 — CID 114811414
ethyl 5-(ethylsulfamoylamino)-3-methylthiophene-2-carboxylate (PubChem CID 114811414) has the molecular formula C10H16N2O4S2 and a molecular weight of 292.38 g/mol. Its IUPAC name is ethyl 5-(ethylsulfamoylamino)-3-methylthiophene-2-carboxylate.
| Compound Name | ethyl 5-(ethylsulfamoylamino)-3-methylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 114811414 |
| Molecular Formula | C10H16N2O4S2 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.06 |
| IUPAC Name | ethyl 5-(ethylsulfamoylamino)-3-methylthiophene-2-carboxylate |
| SMILES | CCNS(=O)(=O)Nc1cc(C)c(C(=O)OCC)s1 |
| InChI | InChI=1S/C10H16N2O4S2/c1-4-11-18(14,15)12-8-6-7(3)9(17-8)10(13)16-5-2/h6,11-12H,4-5H2,1-3H3 |
| InChIKey | AEJGIILMTMOCOG-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |