C12H19NO5S2 — CID 63287775
ethyl 5-(3-methoxypropylsulfonylamino)-3-methylthiophene-2-carboxylate (PubChem CID 63287775) has the molecular formula C12H19NO5S2 and a molecular weight of 321.42 g/mol. Its IUPAC name is ethyl 5-(3-methoxypropylsulfonylamino)-3-methylthiophene-2-carboxylate.
| Compound Name | ethyl 5-(3-methoxypropylsulfonylamino)-3-methylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 63287775 |
| Molecular Formula | C12H19NO5S2 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.07 |
| IUPAC Name | ethyl 5-(3-methoxypropylsulfonylamino)-3-methylthiophene-2-carboxylate |
| SMILES | CCOC(=O)c1sc(NS(=O)(=O)CCCOC)cc1C |
| InChI | InChI=1S/C12H19NO5S2/c1-4-18-12(14)11-9(2)8-10(19-11)13-20(15,16)7-5-6-17-3/h8,13H,4-7H2,1-3H3 |
| InChIKey | LAKZEHZOPCZFOR-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|