C19H23NO6S2 — CID 41273808
ethyl 5-[4-(4-methoxyphenyl)sulfonylbutanoylamino]-3-methylthiophene-2-carboxylate (PubChem CID 41273808) has the molecular formula C19H23NO6S2 and a molecular weight of 425.53 g/mol. Its IUPAC name is ethyl 5-[4-(4-methoxyphenyl)sulfonylbutanoylamino]-3-methylthiophene-2-carboxylate.
| Compound Name | ethyl 5-[4-(4-methoxyphenyl)sulfonylbutanoylamino]-3-methylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 41273808 |
| Molecular Formula | C19H23NO6S2 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.10 |
| IUPAC Name | ethyl 5-[4-(4-methoxyphenyl)sulfonylbutanoylamino]-3-methylthiophene-2-carboxylate |
| SMILES | CCOC(=O)c1sc(NC(=O)CCCS(=O)(=O)c2ccc(OC)cc2)cc1C |
| InChI | InChI=1S/C19H23NO6S2/c1-4-26-19(22)18-13(2)12-17(27-18)20-16(21)6-5-11-28(23,24)15-9-7-14(25-3)8-10-15/h7-10,12H,4-6,11H2,1-3H3,(H,20,21) |
| InChIKey | ZVCLRZWRSBFZSU-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |