C21H25NO6S — CID 55755833
ethyl 5-[4-(4-acetyl-2-methoxyphenoxy)butanoylamino]-3-methylthiophene-2-carboxylate (PubChem CID 55755833) has the molecular formula C21H25NO6S and a molecular weight of 419.50 g/mol. Its IUPAC name is ethyl 5-[4-(4-acetyl-2-methoxyphenoxy)butanoylamino]-3-methylthiophene-2-carboxylate.
| Compound Name | ethyl 5-[4-(4-acetyl-2-methoxyphenoxy)butanoylamino]-3-methylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 55755833 |
| Molecular Formula | C21H25NO6S |
| Molecular Weight | 419.50 g/mol |
| Exact Mass | 419.14 |
| IUPAC Name | ethyl 5-[4-(4-acetyl-2-methoxyphenoxy)butanoylamino]-3-methylthiophene-2-carboxylate |
| SMILES | CCOC(=O)c1sc(NC(=O)CCCOc2ccc(C(C)=O)cc2OC)cc1C |
| InChI | InChI=1S/C21H25NO6S/c1-5-27-21(25)20-13(2)11-19(29-20)22-18(24)7-6-10-28-16-9-8-15(14(3)23)12-17(16)26-4/h8-9,11-12H,5-7,10H2,1-4H3,(H,22,24) |
| InChIKey | NQPNEPCIIXWQAN-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.50 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|