C25H34N2O6S — CID 55758341
ethyl 2-[4-(4-acetyl-2-methoxyphenoxy)butanoyl-pentylamino]-4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 55758341) has the molecular formula C25H34N2O6S and a molecular weight of 490.62 g/mol. Its IUPAC name is ethyl 2-[4-(4-acetyl-2-methoxyphenoxy)butanoyl-pentylamino]-4-methyl-1,3-thiazole-5-carboxylate.
| Compound Name | ethyl 2-[4-(4-acetyl-2-methoxyphenoxy)butanoyl-pentylamino]-4-methyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 55758341 |
| Molecular Formula | C25H34N2O6S |
| Molecular Weight | 490.62 g/mol |
| Exact Mass | 490.21 |
| IUPAC Name | ethyl 2-[4-(4-acetyl-2-methoxyphenoxy)butanoyl-pentylamino]-4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | CCCCCN(C(=O)CCCOc1ccc(C(C)=O)cc1OC)c1nc(C)c(C(=O)OCC)s1 |
| InChI | InChI=1S/C25H34N2O6S/c1-6-8-9-14-27(25-26-17(3)23(34-25)24(30)32-7-2)22(29)11-10-15-33-20-13-12-19(18(4)28)16-21(20)31-5/h12-13,16H,6-11,14-15H2,1-5H3 |
| InChIKey | RACFZBVKCUFHFH-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 95.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.62 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|