C21H26N2O4S — CID 55478685
ethyl 2-[2,3-dihydro-1-benzofuran-2-carbonyl(pentyl)amino]-4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 55478685) has the molecular formula C21H26N2O4S and a molecular weight of 402.52 g/mol. Its IUPAC name is ethyl 2-[2,3-dihydro-1-benzofuran-2-carbonyl(pentyl)amino]-4-methyl-1,3-thiazole-5-carboxylate.
| Compound Name | ethyl 2-[2,3-dihydro-1-benzofuran-2-carbonyl(pentyl)amino]-4-methyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 55478685 |
| Molecular Formula | C21H26N2O4S |
| Molecular Weight | 402.52 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | ethyl 2-[2,3-dihydro-1-benzofuran-2-carbonyl(pentyl)amino]-4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | CCCCCN(C(=O)C1Cc2ccccc2O1)c1nc(C)c(C(=O)OCC)s1 |
| InChI | InChI=1S/C21H26N2O4S/c1-4-6-9-12-23(21-22-14(3)18(28-21)20(25)26-5-2)19(24)17-13-15-10-7-8-11-16(15)27-17/h7-8,10-11,17H,4-6,9,12-13H2,1-3H3 |
| InChIKey | FQYDGDXVBJJBCJ-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.52 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|