C19H31N3O5S2 — CID 55555931
ethyl 4-methyl-2-[(1-methylsulfonylpiperidine-3-carbonyl)-pentylamino]-1,3-thiazole-5-carboxylate (PubChem CID 55555931) has the molecular formula C19H31N3O5S2 and a molecular weight of 445.61 g/mol. Its IUPAC name is ethyl 4-methyl-2-[(1-methylsulfonylpiperidine-3-carbonyl)-pentylamino]-1,3-thiazole-5-carboxylate.
| Compound Name | ethyl 4-methyl-2-[(1-methylsulfonylpiperidine-3-carbonyl)-pentylamino]-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 55555931 |
| Molecular Formula | C19H31N3O5S2 |
| Molecular Weight | 445.61 g/mol |
| Exact Mass | 445.17 |
| IUPAC Name | ethyl 4-methyl-2-[(1-methylsulfonylpiperidine-3-carbonyl)-pentylamino]-1,3-thiazole-5-carboxylate |
| SMILES | CCCCCN(C(=O)C1CCCN(S(C)(=O)=O)C1)c1nc(C)c(C(=O)OCC)s1 |
| InChI | InChI=1S/C19H31N3O5S2/c1-5-7-8-12-22(19-20-14(3)16(28-19)18(24)27-6-2)17(23)15-10-9-11-21(13-15)29(4,25)26/h15H,5-13H2,1-4H3 |
| InChIKey | UTJPHIMKUJNDDJ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 96.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.61 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|