C24H32ClN3O4S — CID 55478086
ethyl 2-[[2-[(2-chlorobenzoyl)amino]-3-methylbutanoyl]-pentylamino]-4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 55478086) has the molecular formula C24H32ClN3O4S and a molecular weight of 494.06 g/mol. Its IUPAC name is ethyl 2-[[2-[(2-chlorobenzoyl)amino]-3-methylbutanoyl]-pentylamino]-4-methyl-1,3-thiazole-5-carboxylate.
| Compound Name | ethyl 2-[[2-[(2-chlorobenzoyl)amino]-3-methylbutanoyl]-pentylamino]-4-methyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 55478086 |
| Molecular Formula | C24H32ClN3O4S |
| Molecular Weight | 494.06 g/mol |
| Exact Mass | 493.18 |
| IUPAC Name | ethyl 2-[[2-[(2-chlorobenzoyl)amino]-3-methylbutanoyl]-pentylamino]-4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | CCCCCN(C(=O)C(NC(=O)c1ccccc1Cl)C(C)C)c1nc(C)c(C(=O)OCC)s1 |
| InChI | InChI=1S/C24H32ClN3O4S/c1-6-8-11-14-28(24-26-16(5)20(33-24)23(31)32-7-2)22(30)19(15(3)4)27-21(29)17-12-9-10-13-18(17)25/h9-10,12-13,15,19H,6-8,11,14H2,1-5H3,(H,27,29) |
| InChIKey | NCUKMDNTKWFPNM-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.06 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|