C22H27N3O4S2 — CID 24582478
ethyl 4-methyl-2-[[2-(3-oxo-1,4-benzothiazin-4-yl)acetyl]-pentylamino]-1,3-thiazole-5-carboxylate (PubChem CID 24582478) has the molecular formula C22H27N3O4S2 and a molecular weight of 461.61 g/mol. Its IUPAC name is ethyl 4-methyl-2-[[2-(3-oxo-1,4-benzothiazin-4-yl)acetyl]-pentylamino]-1,3-thiazole-5-carboxylate.
| Compound Name | ethyl 4-methyl-2-[[2-(3-oxo-1,4-benzothiazin-4-yl)acetyl]-pentylamino]-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 24582478 |
| Molecular Formula | C22H27N3O4S2 |
| Molecular Weight | 461.61 g/mol |
| Exact Mass | 461.14 |
| IUPAC Name | ethyl 4-methyl-2-[[2-(3-oxo-1,4-benzothiazin-4-yl)acetyl]-pentylamino]-1,3-thiazole-5-carboxylate |
| SMILES | CCCCCN(C(=O)CN1C(=O)CSc2ccccc21)c1nc(C)c(C(=O)OCC)s1 |
| InChI | InChI=1S/C22H27N3O4S2/c1-4-6-9-12-24(22-23-15(3)20(31-22)21(28)29-5-2)18(26)13-25-16-10-7-8-11-17(16)30-14-19(25)27/h7-8,10-11H,4-6,9,12-14H2,1-3H3 |
| InChIKey | QJKNMAUXKQKHPK-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 79.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.61 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|