C24H26N4O5S — CID 55478179
ethyl 4-methyl-2-[[2-(4-oxo-[1]benzofuro[3,2-d]pyrimidin-3-yl)acetyl]-pentylamino]-1,3-thiazole-5-carboxylate (PubChem CID 55478179) has the molecular formula C24H26N4O5S and a molecular weight of 482.56 g/mol. Its IUPAC name is ethyl 4-methyl-2-[[2-(4-oxo-[1]benzofuro[3,2-d]pyrimidin-3-yl)acetyl]-pentylamino]-1,3-thiazole-5-carboxylate.
| Compound Name | ethyl 4-methyl-2-[[2-(4-oxo-[1]benzofuro[3,2-d]pyrimidin-3-yl)acetyl]-pentylamino]-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 55478179 |
| Molecular Formula | C24H26N4O5S |
| Molecular Weight | 482.56 g/mol |
| Exact Mass | 482.16 |
| IUPAC Name | ethyl 4-methyl-2-[[2-(4-oxo-[1]benzofuro[3,2-d]pyrimidin-3-yl)acetyl]-pentylamino]-1,3-thiazole-5-carboxylate |
| SMILES | CCCCCN(C(=O)Cn1cnc2c(oc3ccccc32)c1=O)c1nc(C)c(C(=O)OCC)s1 |
| InChI | InChI=1S/C24H26N4O5S/c1-4-6-9-12-28(24-26-15(3)21(34-24)23(31)32-5-2)18(29)13-27-14-25-19-16-10-7-8-11-17(16)33-20(19)22(27)30/h7-8,10-11,14H,4-6,9,12-13H2,1-3H3 |
| InChIKey | ZRRACHRINROIHM-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 107.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.56 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|