C21H18N2O5 — CID 55382859
(4-propoxyphenyl) 2-(4-oxo-[1]benzofuro[3,2-d]pyrimidin-3-yl)acetate (PubChem CID 55382859) has the molecular formula C21H18N2O5 and a molecular weight of 378.38 g/mol. Its IUPAC name is (4-propoxyphenyl) 2-(4-oxo-[1]benzofuro[3,2-d]pyrimidin-3-yl)acetate.
| Compound Name | (4-propoxyphenyl) 2-(4-oxo-[1]benzofuro[3,2-d]pyrimidin-3-yl)acetate |
|---|---|
| PubChem CID | 55382859 |
| Molecular Formula | C21H18N2O5 |
| Molecular Weight | 378.38 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | (4-propoxyphenyl) 2-(4-oxo-[1]benzofuro[3,2-d]pyrimidin-3-yl)acetate |
| SMILES | CCCOc1ccc(OC(=O)Cn2cnc3c(oc4ccccc43)c2=O)cc1 |
| InChI | InChI=1S/C21H18N2O5/c1-2-11-26-14-7-9-15(10-8-14)27-18(24)12-23-13-22-19-16-5-3-4-6-17(16)28-20(19)21(23)25/h3-10,13H,2,11-12H2,1H3 |
| InChIKey | NDUMGFHFSQNASX-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 83.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.38 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|