C19H21N3O5 — CID 32987169
methyl 6-[[2-(4-oxo-[1]benzofuro[3,2-d]pyrimidin-3-yl)acetyl]amino]hexanoate (PubChem CID 32987169) has the molecular formula C19H21N3O5 and a molecular weight of 371.39 g/mol. Its IUPAC name is methyl 6-[[2-(4-oxo-[1]benzofuro[3,2-d]pyrimidin-3-yl)acetyl]amino]hexanoate.
| Compound Name | methyl 6-[[2-(4-oxo-[1]benzofuro[3,2-d]pyrimidin-3-yl)acetyl]amino]hexanoate |
|---|---|
| PubChem CID | 32987169 |
| Molecular Formula | C19H21N3O5 |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | methyl 6-[[2-(4-oxo-[1]benzofuro[3,2-d]pyrimidin-3-yl)acetyl]amino]hexanoate |
| SMILES | COC(=O)CCCCCNC(=O)Cn1cnc2c(oc3ccccc32)c1=O |
| InChI | InChI=1S/C19H21N3O5/c1-26-16(24)9-3-2-6-10-20-15(23)11-22-12-21-17-13-7-4-5-8-14(13)27-18(17)19(22)25/h4-5,7-8,12H,2-3,6,9-11H2,1H3,(H,20,23) |
| InChIKey | IUNRKEKIXYGXSI-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 103.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|