C21H26N4O3 — CID 119620632
N-[2-(cycloheptylamino)ethyl]-2-(4-oxo-[1]benzofuro[3,2-d]pyrimidin-3-yl)acetamide (PubChem CID 119620632) has the molecular formula C21H26N4O3 and a molecular weight of 382.46 g/mol. Its IUPAC name is N-[2-(cycloheptylamino)ethyl]-2-(4-oxo-[1]benzofuro[3,2-d]pyrimidin-3-yl)acetamide.
| Compound Name | N-[2-(cycloheptylamino)ethyl]-2-(4-oxo-[1]benzofuro[3,2-d]pyrimidin-3-yl)acetamide |
|---|---|
| PubChem CID | 119620632 |
| Molecular Formula | C21H26N4O3 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | N-[2-(cycloheptylamino)ethyl]-2-(4-oxo-[1]benzofuro[3,2-d]pyrimidin-3-yl)acetamide |
| SMILES | O=C(Cn1cnc2c(oc3ccccc32)c1=O)NCCNC1CCCCCC1 |
| InChI | InChI=1S/C21H26N4O3/c26-18(23-12-11-22-15-7-3-1-2-4-8-15)13-25-14-24-19-16-9-5-6-10-17(16)28-20(19)21(25)27/h5-6,9-10,14-15,22H,1-4,7-8,11-13H2,(H,23,26) |
| InChIKey | FCFQQXUKZIVDMC-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 89.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|