C24H24N4O3 — CID 26817386
N-[4-(azepan-1-yl)phenyl]-2-(4-oxo-[1]benzofuro[3,2-d]pyrimidin-3-yl)acetamide (PubChem CID 26817386) has the molecular formula C24H24N4O3 and a molecular weight of 416.48 g/mol. Its IUPAC name is N-[4-(azepan-1-yl)phenyl]-2-(4-oxo-[1]benzofuro[3,2-d]pyrimidin-3-yl)acetamide.
| Compound Name | N-[4-(azepan-1-yl)phenyl]-2-(4-oxo-[1]benzofuro[3,2-d]pyrimidin-3-yl)acetamide |
|---|---|
| PubChem CID | 26817386 |
| Molecular Formula | C24H24N4O3 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | N-[4-(azepan-1-yl)phenyl]-2-(4-oxo-[1]benzofuro[3,2-d]pyrimidin-3-yl)acetamide |
| SMILES | O=C(Cn1cnc2c(oc3ccccc32)c1=O)Nc1ccc(N2CCCCCC2)cc1 |
| InChI | InChI=1S/C24H24N4O3/c29-21(26-17-9-11-18(12-10-17)27-13-5-1-2-6-14-27)15-28-16-25-22-19-7-3-4-8-20(19)31-23(22)24(28)30/h3-4,7-12,16H,1-2,5-6,13-15H2,(H,26,29) |
| InChIKey | PURJAFKEMPGYSB-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 80.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|